C26H24F4N6O2 — CID 164622005
15-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-9-propan-2-yl-5-(trifluoromethyl)-4,9,12,14,16-pentazatetracyclo[9.6.1.02,7.014,18]octadeca-1(17),2,4,6,12-pentaen-10-one (PubChem CID 164622005) has the molecular formula C26H24F4N6O2 and a molecular weight of 528.51 g/mol. Its IUPAC name is 15-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-9-propan-2-yl-5-(trifluoromethyl)-4,9,12,14,16-pentazatetracyclo[9.6.1.02,7.014,18]octadeca-1(17),2,4,6,12-pentaen-10-one.
| Compound Name | 15-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-9-propan-2-yl-5-(trifluoromethyl)-4,9,12,14,16-pentazatetracyclo[9.6.1.02,7.014,18]octadeca-1(17),2,4,6,12-pentaen-10-one |
|---|---|
| PubChem CID | 164622005 |
| Molecular Formula | C26H24F4N6O2 |
| Molecular Weight | 528.51 g/mol |
| Exact Mass | 528.19 |
| IUPAC Name | 15-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-9-propan-2-yl-5-(trifluoromethyl)-4,9,12,14,16-pentazatetracyclo[9.6.1.02,7.014,18]octadeca-1(17),2,4,6,12-pentaen-10-one |
| SMILES | CC(C)N1Cc2cc(C(F)(F)F)ncc2C2=CN/C(=N\Cc3c(F)ccc4c3CCO4)N3C=NC(C1=O)C23 |
| InChI | InChI=1S/C26H24F4N6O2/c1-13(2)35-11-14-7-21(26(28,29)30)31-8-16(14)18-10-33-25(36-12-34-22(23(18)36)24(35)37)32-9-17-15-5-6-38-20(15)4-3-19(17)27/h3-4,7-8,10,12-13,22-23H,5-6,9,11H2,1-2H3,(H,32,33) |
| InChIKey | BNVSAXDUUSCZQU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|