C26H30N2O7 — CID 164622079
2-(2-oxopiperidin-3-yl)-4-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]isoindole-1,3-dione (PubChem CID 164622079) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is 2-(2-oxopiperidin-3-yl)-4-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]isoindole-1,3-dione.
| Compound Name | 2-(2-oxopiperidin-3-yl)-4-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 164622079 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 2-(2-oxopiperidin-3-yl)-4-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]isoindole-1,3-dione |
| SMILES | O=C1NCCCC1N1C(=O)c2cccc(OCCOCCOCCOCc3ccccc3)c2C1=O |
| InChI | InChI=1S/C26H30N2O7/c29-24-21(9-5-11-27-24)28-25(30)20-8-4-10-22(23(20)26(28)31)35-17-16-33-13-12-32-14-15-34-18-19-6-2-1-3-7-19/h1-4,6-8,10,21H,5,9,11-18H2,(H,27,29) |
| InChIKey | GRPCVZIUVZCWGX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|