About S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate
S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate (PubChem CID 164622145) has the molecular formula C13H7BrN2O2S2
and a molecular weight of 367.25 g/mol. Its IUPAC name is S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate.
Molecular Properties
| Compound Name | S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate |
| PubChem CID | 164622145 |
| Molecular Formula | C13H7BrN2O2S2 |
| Molecular Weight | 367.25 g/mol |
| Exact Mass | 365.91 |
| IUPAC Name | S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate |
| SMILES | O=C(Sc1nncs1)c1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C13H7BrN2O2S2/c14-9-3-1-8(2-4-9)10-5-6-11(18-10)12(17)20-13-16-15-7-19-13/h1-7H |
| InChIKey | HBVRTQPHOLJVAE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate?
The IUPAC name of S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate (CID 164622145) is S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate.
What is the SMILES notation for S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate?
The canonical SMILES for S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate is O=C(Sc1nncs1)c1ccc(-c2ccc(Br)cc2)o1.
What is the InChIKey of S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate?
The InChIKey is HBVRTQPHOLJVAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7BrN2O2S2/c14-9-3-1-8(2-4-9)10-5-6-11(18-10)12(17)20-13-16-15-7-19-13/h1-7H.
What are the key properties of S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate?
S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate has a molecular weight of 367.25 g/mol, XLogP of 4.49, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for S-(1,3,4-thiadiazol-2-yl) 5-(4-bromophenyl)furan-2-carbothioate is sourced from PubChem (CID 164622145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).