C18H30O2 — CID 164622187
(2E,6E,10E)-3,7,11-trimethyl-12-prop-2-enoxydodeca-2,6,10-trien-1-ol (PubChem CID 164622187) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is (2E,6E,10E)-3,7,11-trimethyl-12-prop-2-enoxydodeca-2,6,10-trien-1-ol.
| Compound Name | (2E,6E,10E)-3,7,11-trimethyl-12-prop-2-enoxydodeca-2,6,10-trien-1-ol |
|---|---|
| PubChem CID | 164622187 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | (2E,6E,10E)-3,7,11-trimethyl-12-prop-2-enoxydodeca-2,6,10-trien-1-ol |
| SMILES | C=CCOC/C(C)=C/CC/C(C)=C/CC/C(C)=C/CO |
| InChI | InChI=1S/C18H30O2/c1-5-14-20-15-18(4)11-7-9-16(2)8-6-10-17(3)12-13-19/h5,8,11-12,19H,1,6-7,9-10,13-15H2,2-4H3/b16-8+,17-12+,18-11+ |
| InChIKey | MFLOHLWWWWKJGI-SZPHWZFISA-N |
| XLogP | 4.58 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|