C26H39FO2 — CID 164622246
(2R,4aS,8aS)-1-[(E,3R)-5-(4-fluorophenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol (PubChem CID 164622246) has the molecular formula C26H39FO2 and a molecular weight of 402.59 g/mol. Its IUPAC name is (2R,4aS,8aS)-1-[(E,3R)-5-(4-fluorophenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (2R,4aS,8aS)-1-[(E,3R)-5-(4-fluorophenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 164622246 |
| Molecular Formula | C26H39FO2 |
| Molecular Weight | 402.59 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | (2R,4aS,8aS)-1-[(E,3R)-5-(4-fluorophenyl)-3-hydroxy-3-methylpent-4-enyl]-2,5,5,8a-tetramethyl-3,4,4a,6,7,8-hexahydro-1H-naphthalen-2-ol |
| SMILES | CC1(C)CCC[C@]2(C)C(CC[C@@](C)(O)/C=C/c3ccc(F)cc3)[C@](C)(O)CC[C@@H]12 |
| InChI | InChI=1S/C26H39FO2/c1-23(2)14-6-15-25(4)21(23)13-18-26(5,29)22(25)12-17-24(3,28)16-11-19-7-9-20(27)10-8-19/h7-11,16,21-22,28-29H,6,12-15,17-18H2,1-5H3/b16-11+/t21-,22?,24-,25-,26+/m0/s1 |
| InChIKey | GWSONKVCRUEAOD-MRPXYESISA-N |
| XLogP | 6.36 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.59 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |