C17H18N8O2 — CID 164622255
5-[4-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazolo[3,4-d]pyrimidin-1-yl]-N-hydroxypentanamide (PubChem CID 164622255) has the molecular formula C17H18N8O2 and a molecular weight of 366.39 g/mol. Its IUPAC name is 5-[4-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazolo[3,4-d]pyrimidin-1-yl]-N-hydroxypentanamide.
| Compound Name | 5-[4-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazolo[3,4-d]pyrimidin-1-yl]-N-hydroxypentanamide |
|---|---|
| PubChem CID | 164622255 |
| Molecular Formula | C17H18N8O2 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 5-[4-amino-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)pyrazolo[3,4-d]pyrimidin-1-yl]-N-hydroxypentanamide |
| SMILES | Nc1ncnc2c1c(-c1cnc3[nH]ccc3c1)nn2CCCCC(=O)NO |
| InChI | InChI=1S/C17H18N8O2/c18-15-13-14(11-7-10-4-5-19-16(10)20-8-11)23-25(17(13)22-9-21-15)6-2-1-3-12(26)24-27/h4-5,7-9,27H,1-3,6H2,(H,19,20)(H,24,26)(H2,18,21,22) |
| InChIKey | XBZCFNFYWGDCKT-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 147.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|