C23H30O5 — CID 164622276
(2R)-5-hydroxy-2-[(3R)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromene-6-carboxylic acid (PubChem CID 164622276) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (2R)-5-hydroxy-2-[(3R)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromene-6-carboxylic acid.
| Compound Name | (2R)-5-hydroxy-2-[(3R)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromene-6-carboxylic acid |
|---|---|
| PubChem CID | 164622276 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (2R)-5-hydroxy-2-[(3R)-3-hydroxy-8-methyl-4-methylidenenon-7-enyl]-2,7-dimethylchromene-6-carboxylic acid |
| SMILES | C=C(CCC=C(C)C)[C@H](O)CC[C@]1(C)C=Cc2c(cc(C)c(C(=O)O)c2O)O1 |
| InChI | InChI=1S/C23H30O5/c1-14(2)7-6-8-15(3)18(24)10-12-23(5)11-9-17-19(28-23)13-16(4)20(21(17)25)22(26)27/h7,9,11,13,18,24-25H,3,6,8,10,12H2,1-2,4-5H3,(H,26,27)/t18-,23+/m1/s1 |
| InChIKey | ATHUNASCPMPZIQ-JPYJTQIMSA-N |
| XLogP | 5.01 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|