C33H51NO4 — CID 164622348
2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-(piperidin-1-ylmethyl)-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol (PubChem CID 164622348) has the molecular formula C33H51NO4 and a molecular weight of 525.80 g/mol. Its IUPAC name is 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-(piperidin-1-ylmethyl)-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol.
| Compound Name | 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-(piperidin-1-ylmethyl)-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol |
|---|---|
| PubChem CID | 164622348 |
| Molecular Formula | C33H51NO4 |
| Molecular Weight | 525.80 g/mol |
| Exact Mass | 525.38 |
| IUPAC Name | 2-[(4E,8E)-11-[(2R)-6-hydroxy-2,8-dimethyl-5-(piperidin-1-ylmethyl)-3,4-dihydrochromen-2-yl]-4,8-dimethylundeca-4,8-dienylidene]propane-1,3-diol |
| SMILES | CC1=CC(=C(C2=C1O[C@](CC2)(C)CC/C=C(\C)/CC/C=C(\C)/CCC=C(CO)CO)CN3CCCCC3)O |
| InChI | InChI=1S/C33H51NO4/c1-25(13-9-15-28(23-35)24-36)11-8-12-26(2)14-10-17-33(4)18-16-29-30(22-34-19-6-5-7-20-34)31(37)21-27(3)32(29)38-33/h11,14-15,21,35-37H,5-10,12-13,16-20,22-24H2,1-4H3/b25-11+,26-14+/t33-/m1/s1 |
| InChIKey | AIUWMLSHQNDKMG-RPIXCULZSA-N |
| XLogP | 6.80 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | 793 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.80 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|