About 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine
4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine (PubChem CID 164622513) has the molecular formula C12H12N6
and a molecular weight of 240.27 g/mol. Its IUPAC name is 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine |
| PubChem CID | 164622513 |
| Molecular Formula | C12H12N6 |
| Molecular Weight | 240.27 g/mol |
| Exact Mass | 240.11 |
| IUPAC Name | 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine |
| SMILES | CN(C)c1nccc(-c2cnc3ncccn23)n1 |
| InChI | InChI=1S/C12H12N6/c1-17(2)12-14-6-4-9(16-12)10-8-15-11-13-5-3-7-18(10)11/h3-8H,1-2H3 |
| InChIKey | UYXOVPJCCPREHU-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 59.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.27 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine?
The IUPAC name of 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine (CID 164622513) is 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine.
What is the SMILES notation for 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine?
The canonical SMILES for 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine is CN(C)c1nccc(-c2cnc3ncccn23)n1.
What is the InChIKey of 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine?
The InChIKey is UYXOVPJCCPREHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N6/c1-17(2)12-14-6-4-9(16-12)10-8-15-11-13-5-3-7-18(10)11/h3-8H,1-2H3.
What are the key properties of 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine?
4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine has a molecular weight of 240.27 g/mol, XLogP of 1.25, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-imidazo[1,2-a]pyrimidin-3-yl-N,N-dimethylpyrimidin-2-amine is sourced from PubChem (CID 164622513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).