C26H24N2O4 — CID 164622537
[4-(2,3-dihydro-1,4-benzodioxin-6-yl)indol-1-yl]-[4-[(2-hydroxyethylamino)methyl]phenyl]methanone (PubChem CID 164622537) has the molecular formula C26H24N2O4 and a molecular weight of 428.49 g/mol. Its IUPAC name is [4-(2,3-dihydro-1,4-benzodioxin-6-yl)indol-1-yl]-[4-[(2-hydroxyethylamino)methyl]phenyl]methanone.
| Compound Name | [4-(2,3-dihydro-1,4-benzodioxin-6-yl)indol-1-yl]-[4-[(2-hydroxyethylamino)methyl]phenyl]methanone |
|---|---|
| PubChem CID | 164622537 |
| Molecular Formula | C26H24N2O4 |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | [4-(2,3-dihydro-1,4-benzodioxin-6-yl)indol-1-yl]-[4-[(2-hydroxyethylamino)methyl]phenyl]methanone |
| SMILES | O=C(c1ccc(CNCCO)cc1)n1ccc2c(-c3ccc4c(c3)OCCO4)cccc21 |
| InChI | InChI=1S/C26H24N2O4/c29-13-11-27-17-18-4-6-19(7-5-18)26(30)28-12-10-22-21(2-1-3-23(22)28)20-8-9-24-25(16-20)32-15-14-31-24/h1-10,12,16,27,29H,11,13-15,17H2 |
| InChIKey | QCSRDNVLYZNZLX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|