C24H25NO3 — CID 164622560
(1S,2S,4R,7E,11S,12Z)-4,8-dimethyl-12-(quinolin-6-ylmethylidene)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one (PubChem CID 164622560) has the molecular formula C24H25NO3 and a molecular weight of 375.47 g/mol. Its IUPAC name is (1S,2S,4R,7E,11S,12Z)-4,8-dimethyl-12-(quinolin-6-ylmethylidene)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one.
| Compound Name | (1S,2S,4R,7E,11S,12Z)-4,8-dimethyl-12-(quinolin-6-ylmethylidene)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
|---|---|
| PubChem CID | 164622560 |
| Molecular Formula | C24H25NO3 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | (1S,2S,4R,7E,11S,12Z)-4,8-dimethyl-12-(quinolin-6-ylmethylidene)-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-13-one |
| SMILES | C/C1=C\CC[C@@]2(C)O[C@H]2[C@H]2OC(=O)/C(=C\c3ccc4ncccc4c3)[C@@H]2CC1 |
| InChI | InChI=1S/C24H25NO3/c1-15-5-3-11-24(2)22(28-24)21-18(9-7-15)19(23(26)27-21)14-16-8-10-20-17(13-16)6-4-12-25-20/h4-6,8,10,12-14,18,21-22H,3,7,9,11H2,1-2H3/b15-5+,19-14-/t18-,21-,22-,24+/m0/s1 |
| InChIKey | JKBIHAAYIWPGDJ-PDPKGNBASA-N |
| XLogP | 4.84 |
| TPSA | 51.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|