C37H45F3N5O3+ — CID 164622567
N-(3,5-difluorophenyl)-7-(dimethylamino)-1-[4-[7-(1-ethylpiperidin-1-ium-1-yl)heptoxy]-2-fluorophenyl]-4-oxo-1,8-naphthyridine-3-carboxamide (PubChem CID 164622567) has the molecular formula C37H45F3N5O3+ and a molecular weight of 664.79 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-7-(dimethylamino)-1-[4-[7-(1-ethylpiperidin-1-ium-1-yl)heptoxy]-2-fluorophenyl]-4-oxo-1,8-naphthyridine-3-carboxamide.
| Compound Name | N-(3,5-difluorophenyl)-7-(dimethylamino)-1-[4-[7-(1-ethylpiperidin-1-ium-1-yl)heptoxy]-2-fluorophenyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 164622567 |
| Molecular Formula | C37H45F3N5O3+ |
| Molecular Weight | 664.79 g/mol |
| Exact Mass | 664.35 |
| IUPAC Name | N-(3,5-difluorophenyl)-7-(dimethylamino)-1-[4-[7-(1-ethylpiperidin-1-ium-1-yl)heptoxy]-2-fluorophenyl]-4-oxo-1,8-naphthyridine-3-carboxamide |
| SMILES | CC[N+]1(CCCCCCCOc2ccc(-n3cc(C(=O)Nc4cc(F)cc(F)c4)c(=O)c4ccc(N(C)C)nc43)c(F)c2)CCCCC1 |
| InChI | InChI=1S/C37H44F3N5O3/c1-4-45(18-10-8-11-19-45)17-9-6-5-7-12-20-48-29-13-15-33(32(40)24-29)44-25-31(37(47)41-28-22-26(38)21-27(39)23-28)35(46)30-14-16-34(43(2)3)42-36(30)44/h13-16,21-25H,4-12,17-20H2,1-3H3/p+1 |
| InChIKey | NTWWRAUHZDEODD-UHFFFAOYSA-O |
| XLogP | 7.47 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.79 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|