C20H16N6S — CID 164622669
3-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]propanenitrile (PubChem CID 164622669) has the molecular formula C20H16N6S and a molecular weight of 372.46 g/mol. Its IUPAC name is 3-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]propanenitrile.
| Compound Name | 3-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 164622669 |
| Molecular Formula | C20H16N6S |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 3-[4-[4-(5-methylthiophen-2-yl)-3,8,10-triazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]pyrazol-1-yl]propanenitrile |
| SMILES | Cc1ccc(-c2cc3cnc4[nH]ccc4c3n2-c2cnn(CCC#N)c2)s1 |
| InChI | InChI=1S/C20H16N6S/c1-13-3-4-18(27-13)17-9-14-10-23-20-16(5-7-22-20)19(14)26(17)15-11-24-25(12-15)8-2-6-21/h3-5,7,9-12H,2,8H2,1H3,(H,22,23) |
| InChIKey | OZQMUXXGGUOCJI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 75.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |