About 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea
1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea (PubChem CID 164622777) has the molecular formula C16H15Cl2N7O
and a molecular weight of 392.25 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea.
Molecular Properties
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea |
| PubChem CID | 164622777 |
| Molecular Formula | C16H15Cl2N7O |
| Molecular Weight | 392.25 g/mol |
| Exact Mass | 391.07 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea |
| SMILES | Cc1cc(NNC(=O)Nc2cc(Cl)nc(Cl)c2)ncc1-c1cnn(C)c1 |
| InChI | InChI=1S/C16H15Cl2N7O/c1-9-3-15(19-7-12(9)10-6-20-25(2)8-10)23-24-16(26)21-11-4-13(17)22-14(18)5-11/h3-8H,1-2H3,(H,19,23)(H2,21,22,24,26) |
| InChIKey | WXWNPQSQCBBZMR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea?
The IUPAC name of 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea (CID 164622777) is 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea.
What is the SMILES notation for 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea?
The canonical SMILES for 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea is Cc1cc(NNC(=O)Nc2cc(Cl)nc(Cl)c2)ncc1-c1cnn(C)c1.
What is the InChIKey of 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea?
The InChIKey is WXWNPQSQCBBZMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15Cl2N7O/c1-9-3-15(19-7-12(9)10-6-20-25(2)8-10)23-24-16(26)21-11-4-13(17)22-14(18)5-11/h3-8H,1-2H3,(H,19,23)(H2,21,22,24,26).
What are the key properties of 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea?
1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea has a molecular weight of 392.25 g/mol, XLogP of 3.64, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,6-dichloro-4-pyridinyl)-3-[[4-methyl-5-(1-methylpyrazol-4-yl)-2-pyridinyl]amino]urea is sourced from PubChem (CID 164622777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).