C17H27NO3 — CID 164622866
(3R,3aS,5aR,6R,9aS,9bS)-3-[(dimethylamino)methyl]-6-hydroxy-5a,9-dimethyl-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-2-one (PubChem CID 164622866) has the molecular formula C17H27NO3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (3R,3aS,5aR,6R,9aS,9bS)-3-[(dimethylamino)methyl]-6-hydroxy-5a,9-dimethyl-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-2-one.
| Compound Name | (3R,3aS,5aR,6R,9aS,9bS)-3-[(dimethylamino)methyl]-6-hydroxy-5a,9-dimethyl-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-2-one |
|---|---|
| PubChem CID | 164622866 |
| Molecular Formula | C17H27NO3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | (3R,3aS,5aR,6R,9aS,9bS)-3-[(dimethylamino)methyl]-6-hydroxy-5a,9-dimethyl-3,3a,4,5,6,7,9a,9b-octahydrobenzo[g][1]benzofuran-2-one |
| SMILES | CC1=CC[C@@H](O)[C@]2(C)CC[C@@H]3[C@H](OC(=O)[C@H]3CN(C)C)[C@@H]12 |
| InChI | InChI=1S/C17H27NO3/c1-10-5-6-13(19)17(2)8-7-11-12(9-18(3)4)16(20)21-15(11)14(10)17/h5,11-15,19H,6-9H2,1-4H3/t11-,12-,13+,14+,15-,17-/m0/s1 |
| InChIKey | JSKUSGWLZCVBNC-QARARZEYSA-N |
| XLogP | 1.83 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|