C19H18IN3O — CID 164622946
8-ethyl-6-methoxy-4-phenyl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene iodide (PubChem CID 164622946) has the molecular formula C19H18IN3O and a molecular weight of 431.28 g/mol. Its IUPAC name is 8-ethyl-6-methoxy-4-phenyl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene iodide.
| Compound Name | 8-ethyl-6-methoxy-4-phenyl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene iodide |
|---|---|
| PubChem CID | 164622946 |
| Molecular Formula | C19H18IN3O |
| Molecular Weight | 431.28 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 8-ethyl-6-methoxy-4-phenyl-1,5-diaza-8-azoniatricyclo[7.4.0.02,7]trideca-2,4,6,8,10,12-hexaene iodide |
| SMILES | CC[n+]1c2c(OC)nc(-c3ccccc3)cc2n2ccccc21.[I-] |
| InChI | InChI=1S/C19H18N3O.HI/c1-3-21-17-11-7-8-12-22(17)16-13-15(14-9-5-4-6-10-14)20-19(23-2)18(16)21;/h4-13H,3H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | LSAVMRBTZQXHNO-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 30.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.28 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|