C29H24ClF7N2O3 — CID 164622982
(1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[6-chloro-3-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-2-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one (PubChem CID 164622982) has the molecular formula C29H24ClF7N2O3 and a molecular weight of 616.96 g/mol. Its IUPAC name is (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[6-chloro-3-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-2-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one.
| Compound Name | (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[6-chloro-3-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-2-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
|---|---|
| PubChem CID | 164622982 |
| Molecular Formula | C29H24ClF7N2O3 |
| Molecular Weight | 616.96 g/mol |
| Exact Mass | 616.14 |
| IUPAC Name | (1R,5S,7aS)-1-[3,5-bis(trifluoromethyl)phenyl]-5-[6-chloro-3-(4-fluoro-2-methoxy-5-propan-2-ylphenyl)-2-pyridinyl]-5,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-3-one |
| SMILES | COc1cc(F)c(C(C)C)cc1-c1ccc(Cl)nc1[C@@H]1CC[C@H]2[C@@H](c3cc(C(F)(F)F)cc(C(F)(F)F)c3)OC(=O)N12 |
| InChI | InChI=1S/C29H24ClF7N2O3/c1-13(2)18-11-19(23(41-3)12-20(18)31)17-4-7-24(30)38-25(17)21-5-6-22-26(42-27(40)39(21)22)14-8-15(28(32,33)34)10-16(9-14)29(35,36)37/h4,7-13,21-22,26H,5-6H2,1-3H3/t21-,22-,26+/m0/s1 |
| InChIKey | QRSXFQCRWQVNIH-AOJNWGRGSA-N |
| XLogP | 9.11 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.96 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|