C22H34O4 — CID 164622990
[(1S,3Z,7E,11S,12R)-11-hydroxy-7,11-dimethyl-14-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-3,7,13-trien-3-yl]methyl acetate (PubChem CID 164622990) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is [(1S,3Z,7E,11S,12R)-11-hydroxy-7,11-dimethyl-14-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-3,7,13-trien-3-yl]methyl acetate.
| Compound Name | [(1S,3Z,7E,11S,12R)-11-hydroxy-7,11-dimethyl-14-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-3,7,13-trien-3-yl]methyl acetate |
|---|---|
| PubChem CID | 164622990 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | [(1S,3Z,7E,11S,12R)-11-hydroxy-7,11-dimethyl-14-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-3,7,13-trien-3-yl]methyl acetate |
| SMILES | CC(=O)OC/C1=C\CC/C(C)=C/CC[C@](C)(O)[C@H]2C=C(C(C)C)[C@H](C1)O2 |
| InChI | InChI=1S/C22H34O4/c1-15(2)19-13-21-22(5,24)11-7-9-16(3)8-6-10-18(12-20(19)26-21)14-25-17(4)23/h9-10,13,15,20-21,24H,6-8,11-12,14H2,1-5H3/b16-9+,18-10-/t20-,21+,22-/m0/s1 |
| InChIKey | KOPSTNGBGLVDSM-RUKLBKMESA-N |
| XLogP | 4.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|