C21H28O3 — CID 164623042
(1R,4S,10R,13S)-13-hydroxy-5,5-dimethyl-15-propan-2-yltetracyclo[8.6.0.01,13.04,9]hexadeca-8,15-diene-12,14-dione (PubChem CID 164623042) has the molecular formula C21H28O3 and a molecular weight of 328.45 g/mol. Its IUPAC name is (1R,4S,10R,13S)-13-hydroxy-5,5-dimethyl-15-propan-2-yltetracyclo[8.6.0.01,13.04,9]hexadeca-8,15-diene-12,14-dione.
| Compound Name | (1R,4S,10R,13S)-13-hydroxy-5,5-dimethyl-15-propan-2-yltetracyclo[8.6.0.01,13.04,9]hexadeca-8,15-diene-12,14-dione |
|---|---|
| PubChem CID | 164623042 |
| Molecular Formula | C21H28O3 |
| Molecular Weight | 328.45 g/mol |
| Exact Mass | 328.20 |
| IUPAC Name | (1R,4S,10R,13S)-13-hydroxy-5,5-dimethyl-15-propan-2-yltetracyclo[8.6.0.01,13.04,9]hexadeca-8,15-diene-12,14-dione |
| SMILES | CC(C)C1=C[C@]23CC[C@@H]4C(=CCCC4(C)C)[C@H]2CC(=O)[C@]3(O)C1=O |
| InChI | InChI=1S/C21H28O3/c1-12(2)14-11-20-9-7-15-13(6-5-8-19(15,3)4)16(20)10-17(22)21(20,24)18(14)23/h6,11-12,15-16,24H,5,7-10H2,1-4H3/t15-,16-,20-,21+/m1/s1 |
| InChIKey | QNMSALLREMPVDL-NBJYBMASSA-N |
| XLogP | 3.61 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.45 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|