C24H36O6 — CID 164623157
[(3aS,5R,5aS,6S,8R,8aS,9aR)-5,8a-dimethyl-1-methylidene-6-(2-methylpropanoyloxy)-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,7-b]furan-8-yl] 3-methylbutanoate (PubChem CID 164623157) has the molecular formula C24H36O6 and a molecular weight of 420.50 g/mol. Its IUPAC name is [(3aS,5R,5aS,6S,8R,8aS,9aR)-5,8a-dimethyl-1-methylidene-6-(2-methylpropanoyloxy)-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,7-b]furan-8-yl] 3-methylbutanoate.
| Compound Name | [(3aS,5R,5aS,6S,8R,8aS,9aR)-5,8a-dimethyl-1-methylidene-6-(2-methylpropanoyloxy)-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,7-b]furan-8-yl] 3-methylbutanoate |
|---|---|
| PubChem CID | 164623157 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | [(3aS,5R,5aS,6S,8R,8aS,9aR)-5,8a-dimethyl-1-methylidene-6-(2-methylpropanoyloxy)-2-oxo-4,5,5a,6,7,8,9,9a-octahydro-3aH-azuleno[6,7-b]furan-8-yl] 3-methylbutanoate |
| SMILES | C[C@@H]1C[C@H]2[C@H](C[C@]3([C@H]1[C@H](C[C@H]3OC(=O)CC(C)C)OC(=O)C(C)C)C)C(=C)C(=O)O2 |
| InChI | InChI=1S/C24H36O6/c1-12(2)8-20(25)30-19-10-18(29-22(26)13(3)4)21-14(5)9-17-16(11-24(19,21)7)15(6)23(27)28-17/h12-14,16-19,21H,6,8-11H2,1-5,7H3/t14-,16-,17+,18+,19-,21-,24-/m1/s1 |
| InChIKey | WEMUPIAJTMQYHD-KANBNDILSA-N |
| XLogP | 5.10 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | 725 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|