C16H13F3N4O2S — CID 164623166
N-[(E)-[1-oxo-1-[4-(trifluoromethylsulfanyl)anilino]propan-2-ylidene]amino]pyridine-4-carboxamide (PubChem CID 164623166) has the molecular formula C16H13F3N4O2S and a molecular weight of 382.37 g/mol. Its IUPAC name is N-[(E)-[1-oxo-1-[4-(trifluoromethylsulfanyl)anilino]propan-2-ylidene]amino]pyridine-4-carboxamide.
| Compound Name | N-[(E)-[1-oxo-1-[4-(trifluoromethylsulfanyl)anilino]propan-2-ylidene]amino]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 164623166 |
| Molecular Formula | C16H13F3N4O2S |
| Molecular Weight | 382.37 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | N-[(E)-[1-oxo-1-[4-(trifluoromethylsulfanyl)anilino]propan-2-ylidene]amino]pyridine-4-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccncc1)C(=O)Nc1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H13F3N4O2S/c1-10(22-23-15(25)11-6-8-20-9-7-11)14(24)21-12-2-4-13(5-3-12)26-16(17,18)19/h2-9H,1H3,(H,21,24)(H,23,25)/b22-10+ |
| InChIKey | IAJNVUDGCZXPRX-LSHDLFTRSA-N |
| XLogP | 3.44 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|