C41H54N2O4 — CID 164623209
[(3S,6aR,6bS,8aS,11S,14bS)-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-11-(quinolin-3-ylcarbamoyl)-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate (PubChem CID 164623209) has the molecular formula C41H54N2O4 and a molecular weight of 638.89 g/mol. Its IUPAC name is [(3S,6aR,6bS,8aS,11S,14bS)-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-11-(quinolin-3-ylcarbamoyl)-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate.
| Compound Name | [(3S,6aR,6bS,8aS,11S,14bS)-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-11-(quinolin-3-ylcarbamoyl)-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate |
|---|---|
| PubChem CID | 164623209 |
| Molecular Formula | C41H54N2O4 |
| Molecular Weight | 638.89 g/mol |
| Exact Mass | 638.41 |
| IUPAC Name | [(3S,6aR,6bS,8aS,11S,14bS)-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-11-(quinolin-3-ylcarbamoyl)-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)C(CC[C@]3(C)C2C(=O)C=C2C4C[C@@](C)(C(=O)Nc5cnc6ccccc6c5)CC[C@]4(C)CC[C@]23C)C1(C)C |
| InChI | InChI=1S/C41H54N2O4/c1-25(44)47-33-14-15-39(6)32(36(33,2)3)13-16-41(8)34(39)31(45)22-28-29-23-38(5,18-17-37(29,4)19-20-40(28,41)7)35(46)43-27-21-26-11-9-10-12-30(26)42-24-27/h9-12,21-22,24,29,32-34H,13-20,23H2,1-8H3,(H,43,46)/t29?,32?,33-,34?,37+,38-,39-,40+,41+/m0/s1 |
| InChIKey | XAQVSOGYDHLHGA-FFTJLYNLSA-N |
| XLogP | 9.09 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.89 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |