C25H23N5O3 — CID 164623349
4-(4-phenoxyphenyl)-11-prop-2-enoyl-3,6,7,11-tetrazatricyclo[6.5.0.02,6]trideca-1(8),2,4-triene-5-carboxamide (PubChem CID 164623349) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is 4-(4-phenoxyphenyl)-11-prop-2-enoyl-3,6,7,11-tetrazatricyclo[6.5.0.02,6]trideca-1(8),2,4-triene-5-carboxamide.
| Compound Name | 4-(4-phenoxyphenyl)-11-prop-2-enoyl-3,6,7,11-tetrazatricyclo[6.5.0.02,6]trideca-1(8),2,4-triene-5-carboxamide |
|---|---|
| PubChem CID | 164623349 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 4-(4-phenoxyphenyl)-11-prop-2-enoyl-3,6,7,11-tetrazatricyclo[6.5.0.02,6]trideca-1(8),2,4-triene-5-carboxamide |
| SMILES | C=CC(=O)N1CCc2[nH]n3c(C(N)=O)c(-c4ccc(Oc5ccccc5)cc4)nc3c2CC1 |
| InChI | InChI=1S/C25H23N5O3/c1-2-21(31)29-14-12-19-20(13-15-29)28-30-23(24(26)32)22(27-25(19)30)16-8-10-18(11-9-16)33-17-6-4-3-5-7-17/h2-11,28H,1,12-15H2,(H2,26,32) |
| InChIKey | HDKOXFOSUOHRGZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|