C34H31F3N8O7 — CID 164623484
4-[3-[4-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethyl]triazol-1-yl]butyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile (PubChem CID 164623484) has the molecular formula C34H31F3N8O7 and a molecular weight of 720.67 g/mol. Its IUPAC name is 4-[3-[4-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethyl]triazol-1-yl]butyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-[4-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethyl]triazol-1-yl]butyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 164623484 |
| Molecular Formula | C34H31F3N8O7 |
| Molecular Weight | 720.67 g/mol |
| Exact Mass | 720.23 |
| IUPAC Name | 4-[3-[4-[4-[2-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-4-yl]oxyethyl]triazol-1-yl]butyl]-4,4-dimethyl-2,5-dioxoimidazolidin-1-yl]-2-(trifluoromethyl)benzonitrile |
| SMILES | CC1(C)C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)N1CCCCn1cc(CCOc2cccc3c2C(=O)N(C2CCC(=O)NC2=O)C3=O)nn1 |
| InChI | InChI=1S/C34H31F3N8O7/c1-33(2)31(50)44(21-9-8-19(17-38)23(16-21)34(35,36)37)32(51)43(33)14-4-3-13-42-18-20(40-41-42)12-15-52-25-7-5-6-22-27(25)30(49)45(29(22)48)24-10-11-26(46)39-28(24)47/h5-9,16,18,24H,3-4,10-15H2,1-2H3,(H,39,46,47) |
| InChIKey | RNLUIBJKMUUQBP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 187.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.67 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|