C22H18F3N5O — CID 164623511
1-[(4-methoxyphenyl)methyl]-N'-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-c]pyridine-5-carboximidamide (PubChem CID 164623511) has the molecular formula C22H18F3N5O and a molecular weight of 425.41 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-N'-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-c]pyridine-5-carboximidamide.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-N'-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-c]pyridine-5-carboximidamide |
|---|---|
| PubChem CID | 164623511 |
| Molecular Formula | C22H18F3N5O |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-N'-[3-(trifluoromethyl)phenyl]pyrazolo[3,4-c]pyridine-5-carboximidamide |
| SMILES | COc1ccc(Cn2ncc3cc(/C(N)=N/c4cccc(C(F)(F)F)c4)ncc32)cc1 |
| InChI | InChI=1S/C22H18F3N5O/c1-31-18-7-5-14(6-8-18)13-30-20-12-27-19(9-15(20)11-28-30)21(26)29-17-4-2-3-16(10-17)22(23,24)25/h2-12H,13H2,1H3,(H2,26,29) |
| InChIKey | QJGJXLAAZBBKDO-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 78.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|