C34H24F3NO3 — CID 164623554
2-[1-(2-naphthalen-1-yloxyethyl)-3-[3-(trifluoromethyl)phenyl]indol-4-yl]benzoic acid (PubChem CID 164623554) has the molecular formula C34H24F3NO3 and a molecular weight of 551.56 g/mol. Its IUPAC name is 2-[1-(2-naphthalen-1-yloxyethyl)-3-[3-(trifluoromethyl)phenyl]indol-4-yl]benzoic acid.
| Compound Name | 2-[1-(2-naphthalen-1-yloxyethyl)-3-[3-(trifluoromethyl)phenyl]indol-4-yl]benzoic acid |
|---|---|
| PubChem CID | 164623554 |
| Molecular Formula | C34H24F3NO3 |
| Molecular Weight | 551.56 g/mol |
| Exact Mass | 551.17 |
| IUPAC Name | 2-[1-(2-naphthalen-1-yloxyethyl)-3-[3-(trifluoromethyl)phenyl]indol-4-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1cccc2c1c(-c1cccc(C(F)(F)F)c1)cn2CCOc1cccc2ccccc12 |
| InChI | InChI=1S/C34H24F3NO3/c35-34(36,37)24-11-5-10-23(20-24)29-21-38(18-19-41-31-17-6-9-22-8-1-2-12-25(22)31)30-16-7-15-27(32(29)30)26-13-3-4-14-28(26)33(39)40/h1-17,20-21H,18-19H2,(H,39,40) |
| InChIKey | UGIRPCIVVCEJFA-UHFFFAOYSA-N |
| XLogP | 8.92 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.56 |
| LogP ≤ 5 | 8.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |