C14H18N2O9S — CID 164623653
methyl (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4-sulfamoylbenzoyl)amino]oxane-2-carboxylate (PubChem CID 164623653) has the molecular formula C14H18N2O9S and a molecular weight of 390.37 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4-sulfamoylbenzoyl)amino]oxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4-sulfamoylbenzoyl)amino]oxane-2-carboxylate |
|---|---|
| PubChem CID | 164623653 |
| Molecular Formula | C14H18N2O9S |
| Molecular Weight | 390.37 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | methyl (2S,3S,4S,5R,6R)-3,4,5-trihydroxy-6-[(4-sulfamoylbenzoyl)amino]oxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1O[C@@H](NC(=O)c2ccc(S(N)(=O)=O)cc2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H18N2O9S/c1-24-14(21)11-9(18)8(17)10(19)13(25-11)16-12(20)6-2-4-7(5-3-6)26(15,22)23/h2-5,8-11,13,17-19H,1H3,(H,16,20)(H2,15,22,23)/t8-,9-,10+,11-,13+/m0/s1 |
| InChIKey | XOHLGZUPZMCUKF-XPORZQOISA-N |
| XLogP | -2.96 |
| TPSA | 185.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.37 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |