C34H38N6O4S — CID 164623676
2-(3-but-3-enoxyphenyl)-N-[6-[4-[5-[[2-(3-but-3-enoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]acetamide (PubChem CID 164623676) has the molecular formula C34H38N6O4S and a molecular weight of 626.78 g/mol. Its IUPAC name is 2-(3-but-3-enoxyphenyl)-N-[6-[4-[5-[[2-(3-but-3-enoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]acetamide.
| Compound Name | 2-(3-but-3-enoxyphenyl)-N-[6-[4-[5-[[2-(3-but-3-enoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]acetamide |
|---|---|
| PubChem CID | 164623676 |
| Molecular Formula | C34H38N6O4S |
| Molecular Weight | 626.78 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | 2-(3-but-3-enoxyphenyl)-N-[6-[4-[5-[[2-(3-but-3-enoxyphenyl)acetyl]amino]-1,3,4-thiadiazol-2-yl]butyl]pyridazin-3-yl]acetamide |
| SMILES | C=CCCOc1cccc(CC(=O)Nc2ccc(CCCCc3nnc(NC(=O)Cc4cccc(OCCC=C)c4)s3)nn2)c1 |
| InChI | InChI=1S/C34H38N6O4S/c1-3-5-19-43-28-14-9-11-25(21-28)23-31(41)35-30-18-17-27(37-38-30)13-7-8-16-33-39-40-34(45-33)36-32(42)24-26-12-10-15-29(22-26)44-20-6-4-2/h3-4,9-12,14-15,17-18,21-22H,1-2,5-8,13,16,19-20,23-24H2,(H,35,38,41)(H,36,40,42) |
| InChIKey | LJQOONWXJHQEJQ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.78 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|