C23H25F2IN4O — CID 164623699
N-[(2,3-difluoro-4-iodophenyl)methyl]-1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-amine (PubChem CID 164623699) has the molecular formula C23H25F2IN4O and a molecular weight of 538.38 g/mol. Its IUPAC name is N-[(2,3-difluoro-4-iodophenyl)methyl]-1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-amine.
| Compound Name | N-[(2,3-difluoro-4-iodophenyl)methyl]-1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 164623699 |
| Molecular Formula | C23H25F2IN4O |
| Molecular Weight | 538.38 g/mol |
| Exact Mass | 538.10 |
| IUPAC Name | N-[(2,3-difluoro-4-iodophenyl)methyl]-1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-amine |
| SMILES | COc1ccc2nccc(CCN3CCC(NCc4ccc(I)c(F)c4F)CC3)c2n1 |
| InChI | InChI=1S/C23H25F2IN4O/c1-31-20-5-4-19-23(29-20)15(6-10-27-19)7-11-30-12-8-17(9-13-30)28-14-16-2-3-18(26)22(25)21(16)24/h2-6,10,17,28H,7-9,11-14H2,1H3 |
| InChIKey | IJZXBWJKPBRXAR-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.38 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|