C39H34O9 — CID 164623768
[5-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-2-[3-(2,4-dihydroxyphenyl)-5-methylphenyl]-3-hydroxyphenyl] 2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoate (PubChem CID 164623768) has the molecular formula C39H34O9 and a molecular weight of 646.69 g/mol. Its IUPAC name is [5-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-2-[3-(2,4-dihydroxyphenyl)-5-methylphenyl]-3-hydroxyphenyl] 2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoate.
| Compound Name | [5-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-2-[3-(2,4-dihydroxyphenyl)-5-methylphenyl]-3-hydroxyphenyl] 2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoate |
|---|---|
| PubChem CID | 164623768 |
| Molecular Formula | C39H34O9 |
| Molecular Weight | 646.69 g/mol |
| Exact Mass | 646.22 |
| IUPAC Name | [5-[(E)-2-(2,4-dihydroxyphenyl)ethenyl]-2-[3-(2,4-dihydroxyphenyl)-5-methylphenyl]-3-hydroxyphenyl] 2,4-dihydroxy-3-(3-methylbut-2-enyl)benzoate |
| SMILES | CC(C)=CCc1c(O)ccc(C(=O)Oc2cc(/C=C/c3ccc(O)cc3O)cc(O)c2-c2cc(C)cc(-c3ccc(O)cc3O)c2)c1O |
| InChI | InChI=1S/C39H34O9/c1-21(2)4-10-30-32(42)13-12-31(38(30)46)39(47)48-36-17-23(5-6-24-7-8-27(40)19-33(24)43)16-35(45)37(36)26-15-22(3)14-25(18-26)29-11-9-28(41)20-34(29)44/h4-9,11-20,40-46H,10H2,1-3H3/b6-5+ |
| InChIKey | GJCIXVGYFKHBKT-AATRIKPKSA-N |
| XLogP | 8.17 |
| TPSA | 167.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.69 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|