C32H34N2O2 — CID 164623843
N-[(2S,3R)-4-(benzylamino)-3-hydroxy-1-phenylbutan-2-yl]-3,3-diphenylpropanamide (PubChem CID 164623843) has the molecular formula C32H34N2O2 and a molecular weight of 478.64 g/mol. Its IUPAC name is N-[(2S,3R)-4-(benzylamino)-3-hydroxy-1-phenylbutan-2-yl]-3,3-diphenylpropanamide.
| Compound Name | N-[(2S,3R)-4-(benzylamino)-3-hydroxy-1-phenylbutan-2-yl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 164623843 |
| Molecular Formula | C32H34N2O2 |
| Molecular Weight | 478.64 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | N-[(2S,3R)-4-(benzylamino)-3-hydroxy-1-phenylbutan-2-yl]-3,3-diphenylpropanamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)N[C@@H](Cc1ccccc1)[C@H](O)CNCc1ccccc1 |
| InChI | InChI=1S/C32H34N2O2/c35-31(24-33-23-26-15-7-2-8-16-26)30(21-25-13-5-1-6-14-25)34-32(36)22-29(27-17-9-3-10-18-27)28-19-11-4-12-20-28/h1-20,29-31,33,35H,21-24H2,(H,34,36)/t30-,31+/m0/s1 |
| InChIKey | YOQXSWBHQDKMDY-IOWSJCHKSA-N |
| XLogP | 5.09 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.64 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |