About N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide
N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide (PubChem CID 164623877) has the molecular formula C19H16N4O2S2
and a molecular weight of 396.50 g/mol. Its IUPAC name is N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide.
Molecular Properties
| Compound Name | N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide |
| PubChem CID | 164623877 |
| Molecular Formula | C19H16N4O2S2 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(-c2csc3cnc(Nc4ccccc4)nc23)c1 |
| InChI | InChI=1S/C19H16N4O2S2/c1-27(24,25)23-15-9-5-6-13(10-15)16-12-26-17-11-20-19(22-18(16)17)21-14-7-3-2-4-8-14/h2-12,23H,1H3,(H,20,21,22) |
| InChIKey | GICPBWMPLQNXPM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide?
The IUPAC name of N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide (CID 164623877) is N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide.
What is the SMILES notation for N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide?
The canonical SMILES for N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide is CS(=O)(=O)Nc1cccc(-c2csc3cnc(Nc4ccccc4)nc23)c1.
What is the InChIKey of N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide?
The InChIKey is GICPBWMPLQNXPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4O2S2/c1-27(24,25)23-15-9-5-6-13(10-15)16-12-26-17-11-20-19(22-18(16)17)21-14-7-3-2-4-8-14/h2-12,23H,1H3,(H,20,21,22).
What are the key properties of N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide?
N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide has a molecular weight of 396.50 g/mol, XLogP of 4.47, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(2-anilinothieno[3,2-d]pyrimidin-7-yl)phenyl]methanesulfonamide is sourced from PubChem (CID 164623877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).