About 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione
3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione (PubChem CID 164624024) has the molecular formula C26H19N3O4S
and a molecular weight of 469.52 g/mol. Its IUPAC name is 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione.
Molecular Properties
| Compound Name | 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione |
| PubChem CID | 164624024 |
| Molecular Formula | C26H19N3O4S |
| Molecular Weight | 469.52 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c2C(=O)c2c(c(-c4c[nH]c5ccccc45)cn2C)C3=O)cc1 |
| InChI | InChI=1S/C26H19N3O4S/c1-15-7-9-16(10-8-15)34(32,33)29-12-11-18-23(29)26(31)24-22(25(18)30)20(14-28(24)2)19-13-27-21-6-4-3-5-17(19)21/h3-14,27H,1-2H3 |
| InChIKey | CECNXHVMEREREQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 469.52 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione?
The IUPAC name of 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione (CID 164624024) is 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione.
What is the SMILES notation for 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione?
The canonical SMILES for 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione is Cc1ccc(S(=O)(=O)n2ccc3c2C(=O)c2c(c(-c4c[nH]c5ccccc45)cn2C)C3=O)cc1.
What is the InChIKey of 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione?
The InChIKey is CECNXHVMEREREQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H19N3O4S/c1-15-7-9-16(10-8-15)34(32,33)29-12-11-18-23(29)26(31)24-22(25(18)30)20(14-28(24)2)19-13-27-21-6-4-3-5-17(19)21/h3-14,27H,1-2H3.
What are the key properties of 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione?
3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione has a molecular weight of 469.52 g/mol, XLogP of 4.30, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-indol-3-yl)-1-methyl-7-(4-methylphenyl)sulfonylpyrrolo[3,2-f]indole-4,8-dione is sourced from PubChem (CID 164624024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).