About disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol
disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol (PubChem CID 164624215) has the molecular formula C11H16N5Na2O6P
and a molecular weight of 391.23 g/mol. Its IUPAC name is disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol.
Molecular Properties
| Compound Name | disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol |
| PubChem CID | 164624215 |
| Molecular Formula | C11H16N5Na2O6P |
| Molecular Weight | 391.23 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol |
| SMILES | Nc1ncnc2c1ncn2[C@@H](CCOCP(=O)([O-])[O-])OCCO.[Na+].[Na+] |
| InChI | InChI=1S/C11H18N5O6P.2Na/c12-10-9-11(14-5-13-10)16(6-15-9)8(22-4-2-17)1-3-21-7-23(18,19)20;;/h5-6,8,17H,1-4,7H2,(H2,12,13,14)(H2,18,19,20);;/q;2*+1/p-2/t8-;;/m1../s1 |
| InChIKey | ZZNMCBKFCHNOGX-YCBDHFTFSA-L |
| XLogP | -7.80 |
| TPSA | 171.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.23 |
| LogP ≤ 5 | -7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol?
The IUPAC name of disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol (CID 164624215) is disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol.
What is the SMILES notation for disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol?
The canonical SMILES for disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol is Nc1ncnc2c1ncn2[C@@H](CCOCP(=O)([O-])[O-])OCCO.[Na+].[Na+].
What is the InChIKey of disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol?
The InChIKey is ZZNMCBKFCHNOGX-YCBDHFTFSA-L. The full InChI is InChI=1S/C11H18N5O6P.2Na/c12-10-9-11(14-5-13-10)16(6-15-9)8(22-4-2-17)1-3-21-7-23(18,19)20;;/h5-6,8,17H,1-4,7H2,(H2,12,13,14)(H2,18,19,20);;/q;2*+1/p-2/t8-;;/m1../s1.
What are the key properties of disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol?
disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol has a molecular weight of 391.23 g/mol, XLogP of -7.80, 9 rotatable bonds, 2 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;2-[(1R)-1-(6-aminopurin-9-yl)-3-(phosphonatomethoxy)propoxy]ethanol is sourced from PubChem (CID 164624215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).