C22H17N3OS — CID 164624223
3-methyl-8,11-diphenyl-10-thia-3,4,8-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,12-tetraen-7-one (PubChem CID 164624223) has the molecular formula C22H17N3OS and a molecular weight of 371.47 g/mol. Its IUPAC name is 3-methyl-8,11-diphenyl-10-thia-3,4,8-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,12-tetraen-7-one.
| Compound Name | 3-methyl-8,11-diphenyl-10-thia-3,4,8-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,12-tetraen-7-one |
|---|---|
| PubChem CID | 164624223 |
| Molecular Formula | C22H17N3OS |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | 3-methyl-8,11-diphenyl-10-thia-3,4,8-triazatricyclo[7.4.0.02,6]trideca-1(9),2(6),4,12-tetraen-7-one |
| SMILES | Cn1ncc2c(=O)n(-c3ccccc3)c3c(c21)C=CC(c1ccccc1)S3 |
| InChI | InChI=1S/C22H17N3OS/c1-24-20-17-12-13-19(15-8-4-2-5-9-15)27-22(17)25(16-10-6-3-7-11-16)21(26)18(20)14-23-24/h2-14,19H,1H3 |
| InChIKey | NBLLSPTWXPJSPW-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |