C29H32N4O6 — CID 164624228
4-O-(21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15,17,19-heptaen-7-yl) 1-O-(2-morpholin-4-ylethyl) butanedioate (PubChem CID 164624228) has the molecular formula C29H32N4O6 and a molecular weight of 532.60 g/mol. Its IUPAC name is 4-O-(21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15,17,19-heptaen-7-yl) 1-O-(2-morpholin-4-ylethyl) butanedioate.
| Compound Name | 4-O-(21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15,17,19-heptaen-7-yl) 1-O-(2-morpholin-4-ylethyl) butanedioate |
|---|---|
| PubChem CID | 164624228 |
| Molecular Formula | C29H32N4O6 |
| Molecular Weight | 532.60 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | 4-O-(21-methyl-14-oxo-3,13,21-triazapentacyclo[11.8.0.02,10.04,9.015,20]henicosa-2(10),4(9),5,7,15,17,19-heptaen-7-yl) 1-O-(2-morpholin-4-ylethyl) butanedioate |
| SMILES | CN1c2ccccc2C(=O)N2CCc3c([nH]c4ccc(OC(=O)CCC(=O)OCCN5CCOCC5)cc34)C21 |
| InChI | InChI=1S/C29H32N4O6/c1-31-24-5-3-2-4-21(24)29(36)33-11-10-20-22-18-19(6-7-23(22)30-27(20)28(31)33)39-26(35)9-8-25(34)38-17-14-32-12-15-37-16-13-32/h2-7,18,28,30H,8-17H2,1H3 |
| InChIKey | WHMAGSWXYWFXCP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 104.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|