C24H20F4N6O2 — CID 164624251
15-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-9-methyl-5-(trifluoromethyl)-4,9,12,14,16-pentazatetracyclo[9.6.1.02,7.014,18]octadeca-1(17),2,4,6,12-pentaen-10-one (PubChem CID 164624251) has the molecular formula C24H20F4N6O2 and a molecular weight of 500.46 g/mol. Its IUPAC name is 15-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-9-methyl-5-(trifluoromethyl)-4,9,12,14,16-pentazatetracyclo[9.6.1.02,7.014,18]octadeca-1(17),2,4,6,12-pentaen-10-one.
| Compound Name | 15-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-9-methyl-5-(trifluoromethyl)-4,9,12,14,16-pentazatetracyclo[9.6.1.02,7.014,18]octadeca-1(17),2,4,6,12-pentaen-10-one |
|---|---|
| PubChem CID | 164624251 |
| Molecular Formula | C24H20F4N6O2 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | 15-[(5-fluoro-2,3-dihydro-1-benzofuran-4-yl)methylimino]-9-methyl-5-(trifluoromethyl)-4,9,12,14,16-pentazatetracyclo[9.6.1.02,7.014,18]octadeca-1(17),2,4,6,12-pentaen-10-one |
| SMILES | CN1Cc2cc(C(F)(F)F)ncc2C2=CN/C(=N\Cc3c(F)ccc4c3CCO4)N3C=NC(C1=O)C23 |
| InChI | InChI=1S/C24H20F4N6O2/c1-33-10-12-6-19(24(26,27)28)29-7-14(12)16-9-31-23(34-11-32-20(21(16)34)22(33)35)30-8-15-13-4-5-36-18(13)3-2-17(15)25/h2-3,6-7,9,11,20-21H,4-5,8,10H2,1H3,(H,30,31) |
| InChIKey | FCDVIZNUALCVMH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 82.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|