About 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline
2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline (PubChem CID 164624366) has the molecular formula C17H11BF3NO3
and a molecular weight of 345.09 g/mol. Its IUPAC name is 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline.
Molecular Properties
| Compound Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline |
| PubChem CID | 164624366 |
| Molecular Formula | C17H11BF3NO3 |
| Molecular Weight | 345.09 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline |
| SMILES | OB1OCc2cc(Oc3ccc4cc(C(F)(F)F)ccc4n3)ccc21 |
| InChI | InChI=1S/C17H11BF3NO3/c19-17(20,21)12-2-5-15-10(7-12)1-6-16(22-15)25-13-3-4-14-11(8-13)9-24-18(14)23/h1-8,23H,9H2 |
| InChIKey | KGZSJRMZCOFGIJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.09 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline?
The IUPAC name of 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline (CID 164624366) is 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline.
What is the SMILES notation for 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline?
The canonical SMILES for 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline is OB1OCc2cc(Oc3ccc4cc(C(F)(F)F)ccc4n3)ccc21.
What is the InChIKey of 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline?
The InChIKey is KGZSJRMZCOFGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11BF3NO3/c19-17(20,21)12-2-5-15-10(7-12)1-6-16(22-15)25-13-3-4-14-11(8-13)9-24-18(14)23/h1-8,23H,9H2.
What are the key properties of 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline?
2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline has a molecular weight of 345.09 g/mol, XLogP of 3.26, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1-hydroxy-3H-2,1-benzoxaborol-5-yl)oxy]-6-(trifluoromethyl)quinoline is sourced from PubChem (CID 164624366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).