C20H23N7O3 — CID 164624385
N-[(2R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide (PubChem CID 164624385) has the molecular formula C20H23N7O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is N-[(2R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide.
| Compound Name | N-[(2R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 164624385 |
| Molecular Formula | C20H23N7O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | N-[(2R)-1-(hydroxyamino)-1-oxo-3-phenylpropan-2-yl]-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazine-1-carboxamide |
| SMILES | O=C(NO)[C@@H](Cc1ccccc1)NC(=O)N1CCN(c2ncnc3[nH]ccc23)CC1 |
| InChI | InChI=1S/C20H23N7O3/c28-19(25-30)16(12-14-4-2-1-3-5-14)24-20(29)27-10-8-26(9-11-27)18-15-6-7-21-17(15)22-13-23-18/h1-7,13,16,30H,8-12H2,(H,24,29)(H,25,28)(H,21,22,23)/t16-/m1/s1 |
| InChIKey | ZDNKOVSXMPLCPL-MRXNPFEDSA-N |
| XLogP | 0.91 |
| TPSA | 126.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|