C19H26O3 — CID 164624392
[(3S,8S,9Z)-3-hydroxyheptadeca-9,16-dien-4,6-diyn-8-yl] acetate (PubChem CID 164624392) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is [(3S,8S,9Z)-3-hydroxyheptadeca-9,16-dien-4,6-diyn-8-yl] acetate.
| Compound Name | [(3S,8S,9Z)-3-hydroxyheptadeca-9,16-dien-4,6-diyn-8-yl] acetate |
|---|---|
| PubChem CID | 164624392 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | [(3S,8S,9Z)-3-hydroxyheptadeca-9,16-dien-4,6-diyn-8-yl] acetate |
| SMILES | C=CCCCCC/C=C\[C@@H](C#CC#C[C@@H](O)CC)OC(C)=O |
| InChI | InChI=1S/C19H26O3/c1-4-6-7-8-9-10-11-15-19(22-17(3)20)16-13-12-14-18(21)5-2/h4,11,15,18-19,21H,1,5-10H2,2-3H3/b15-11-/t18-,19-/m0/s1 |
| InChIKey | LVZXOYUVMDZJJL-BTSLHJDJSA-N |
| XLogP | 3.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|