C34H38N6O4S — CID 164624432
(14E)-10,19-dioxa-41-thia-2,27,29,30,37,38-hexazapentacyclo[34.2.2.15,9.120,24.128,31]tritetraconta-1(38),5(43),6,8,14,20,22,24(42),28,30,36,39-dodecaene-3,26-dione (PubChem CID 164624432) has the molecular formula C34H38N6O4S and a molecular weight of 626.80 g/mol. Its IUPAC name is (14E)-10,19-dioxa-41-thia-2,27,29,30,37,38-hexazapentacyclo[34.2.2.15,9.120,24.128,31]tritetraconta-1(38),5(43),6,8,14,20,22,24(42),28,30,36,39-dodecaene-3,26-dione.
| Compound Name | (14E)-10,19-dioxa-41-thia-2,27,29,30,37,38-hexazapentacyclo[34.2.2.15,9.120,24.128,31]tritetraconta-1(38),5(43),6,8,14,20,22,24(42),28,30,36,39-dodecaene-3,26-dione |
|---|---|
| PubChem CID | 164624432 |
| Molecular Formula | C34H38N6O4S |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.27 |
| IUPAC Name | (14E)-10,19-dioxa-41-thia-2,27,29,30,37,38-hexazapentacyclo[34.2.2.15,9.120,24.128,31]tritetraconta-1(38),5(43),6,8,14,20,22,24(42),28,30,36,39-dodecaene-3,26-dione |
| SMILES | C1CCC2=NN=C(S2)NC(=O)CC3=CC(=CC=C3)OCCC/C=C/CCCOC4=CC=CC(=C4)CC(=O)NC5=NN=C(C1)C=C5 |
| InChI | InChI=1S/C34H38N6O4S/c41-31-23-25-11-9-14-28(21-25)43-19-7-3-1-2-4-8-20-44-29-15-10-12-26(22-29)24-32(42)36-34-40-39-33(45-34)16-6-5-13-27-17-18-30(35-31)38-37-27/h1-2,9-12,14-15,17-18,21-22H,3-8,13,16,19-20,23-24H2,(H,35,38,41)(H,36,40,42)/b2-1+ |
| InChIKey | RECOJFDNPMLDHZ-OWOJBTEDSA-N |
| XLogP | 5.30 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 45 |
| Complexity | 927 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|