C12H16N2O7S — CID 164624530
4-sulfamoyl-N-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]benzamide (PubChem CID 164624530) has the molecular formula C12H16N2O7S and a molecular weight of 332.33 g/mol. Its IUPAC name is 4-sulfamoyl-N-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]benzamide.
| Compound Name | 4-sulfamoyl-N-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]benzamide |
|---|---|
| PubChem CID | 164624530 |
| Molecular Formula | C12H16N2O7S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 4-sulfamoyl-N-[(2R,3R,4S,5R)-3,4,5-trihydroxyoxan-2-yl]benzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)N[C@@H]2OC[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C12H16N2O7S/c13-22(19,20)7-3-1-6(2-4-7)11(18)14-12-10(17)9(16)8(15)5-21-12/h1-4,8-10,12,15-17H,5H2,(H,14,18)(H2,13,19,20)/t8-,9+,10-,12-/m1/s1 |
| InChIKey | FBFNOTYMUDSZOW-DTHBNOIPSA-N |
| XLogP | -2.50 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | -2.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |