C20H24N6OS — CID 164624585
N-(2-aminophenyl)-6-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]hexanamide (PubChem CID 164624585) has the molecular formula C20H24N6OS and a molecular weight of 396.52 g/mol. Its IUPAC name is N-(2-aminophenyl)-6-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]hexanamide.
| Compound Name | N-(2-aminophenyl)-6-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]hexanamide |
|---|---|
| PubChem CID | 164624585 |
| Molecular Formula | C20H24N6OS |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-(2-aminophenyl)-6-[(4-methyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]hexanamide |
| SMILES | Cn1c(SCCCCCC(=O)Nc2ccccc2N)nnc1-c1ccncc1 |
| InChI | InChI=1S/C20H24N6OS/c1-26-19(15-10-12-22-13-11-15)24-25-20(26)28-14-6-2-3-9-18(27)23-17-8-5-4-7-16(17)21/h4-5,7-8,10-13H,2-3,6,9,14,21H2,1H3,(H,23,27) |
| InChIKey | ZTUDEIWRPCQIEU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 98.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|