C18H15IN2O4 — CID 164624661
(2S)-3-(4-hydroxy-3-iodophenyl)-2-(1H-indole-2-carbonylamino)propanoic acid (PubChem CID 164624661) has the molecular formula C18H15IN2O4 and a molecular weight of 450.23 g/mol. Its IUPAC name is (2S)-3-(4-hydroxy-3-iodophenyl)-2-(1H-indole-2-carbonylamino)propanoic acid.
| Compound Name | (2S)-3-(4-hydroxy-3-iodophenyl)-2-(1H-indole-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 164624661 |
| Molecular Formula | C18H15IN2O4 |
| Molecular Weight | 450.23 g/mol |
| Exact Mass | 450.01 |
| IUPAC Name | (2S)-3-(4-hydroxy-3-iodophenyl)-2-(1H-indole-2-carbonylamino)propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccc(O)c(I)c1)C(=O)O)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C18H15IN2O4/c19-12-7-10(5-6-16(12)22)8-15(18(24)25)21-17(23)14-9-11-3-1-2-4-13(11)20-14/h1-7,9,15,20,22H,8H2,(H,21,23)(H,24,25)/t15-/m0/s1 |
| InChIKey | AIESTZXBULBROJ-HNNXBMFYSA-N |
| XLogP | 2.90 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.23 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|