C23H25F2N5O4 — CID 164624773
11-(2,6-difluoro-3,5-dimethoxyphenyl)-1',13-dimethylspiro[5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-3,4'-piperidine]-4,12-dione (PubChem CID 164624773) has the molecular formula C23H25F2N5O4 and a molecular weight of 473.48 g/mol. Its IUPAC name is 11-(2,6-difluoro-3,5-dimethoxyphenyl)-1',13-dimethylspiro[5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-3,4'-piperidine]-4,12-dione.
| Compound Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-1',13-dimethylspiro[5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-3,4'-piperidine]-4,12-dione |
|---|---|
| PubChem CID | 164624773 |
| Molecular Formula | C23H25F2N5O4 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 11-(2,6-difluoro-3,5-dimethoxyphenyl)-1',13-dimethylspiro[5,7,11,13-tetrazatricyclo[7.4.0.02,6]trideca-1,6,8-triene-3,4'-piperidine]-4,12-dione |
| SMILES | COc1cc(OC)c(F)c(N2Cc3cnc4c(c3N(C)C2=O)C2(CCN(C)CC2)C(=O)N4)c1F |
| InChI | InChI=1S/C23H25F2N5O4/c1-28-7-5-23(6-8-28)15-18-12(10-26-20(15)27-21(23)31)11-30(22(32)29(18)2)19-16(24)13(33-3)9-14(34-4)17(19)25/h9-10H,5-8,11H2,1-4H3,(H,26,27,31) |
| InChIKey | DKYAEOVZIXOJNP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |