C26H28N4O3S — CID 164625189
(2S,3aS,7aS)-N-[(1S)-1-cyano-2-[4-(3-cyano-4-methylsulfonylphenyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide (PubChem CID 164625189) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is (2S,3aS,7aS)-N-[(1S)-1-cyano-2-[4-(3-cyano-4-methylsulfonylphenyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide.
| Compound Name | (2S,3aS,7aS)-N-[(1S)-1-cyano-2-[4-(3-cyano-4-methylsulfonylphenyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 164625189 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | (2S,3aS,7aS)-N-[(1S)-1-cyano-2-[4-(3-cyano-4-methylsulfonylphenyl)phenyl]ethyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide |
| SMILES | CS(=O)(=O)c1ccc(-c2ccc(C[C@@H](C#N)NC(=O)[C@@H]3C[C@@H]4CCCC[C@@H]4N3)cc2)cc1C#N |
| InChI | InChI=1S/C26H28N4O3S/c1-34(32,33)25-11-10-19(13-21(25)15-27)18-8-6-17(7-9-18)12-22(16-28)29-26(31)24-14-20-4-2-3-5-23(20)30-24/h6-11,13,20,22-24,30H,2-5,12,14H2,1H3,(H,29,31)/t20-,22-,23-,24-/m0/s1 |
| InChIKey | JEVLWAWEIDQJSG-BIHRQFPBSA-N |
| XLogP | 3.10 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |