C37H43IN4S — CID 164625357
N,N-dimethyl-4-[(E)-2-[1-methyl-4-[(Z)-[3-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-2-yl]ethenyl]aniline iodide (PubChem CID 164625357) has the molecular formula C37H43IN4S and a molecular weight of 702.75 g/mol. Its IUPAC name is N,N-dimethyl-4-[(E)-2-[1-methyl-4-[(Z)-[3-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-2-yl]ethenyl]aniline iodide.
| Compound Name | N,N-dimethyl-4-[(E)-2-[1-methyl-4-[(Z)-[3-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-2-yl]ethenyl]aniline iodide |
|---|---|
| PubChem CID | 164625357 |
| Molecular Formula | C37H43IN4S |
| Molecular Weight | 702.75 g/mol |
| Exact Mass | 702.23 |
| IUPAC Name | N,N-dimethyl-4-[(E)-2-[1-methyl-4-[(Z)-[3-[3-(4-methylpiperidin-1-yl)propyl]-1,3-benzothiazol-2-ylidene]methyl]quinolin-1-ium-2-yl]ethenyl]aniline iodide |
| SMILES | CC1CCN(CCCN2/C(=C/c3cc(/C=C/c4ccc(N(C)C)cc4)[n+](C)c4ccccc34)Sc3ccccc32)CC1.[I-] |
| InChI | InChI=1S/C37H43N4S.HI/c1-28-20-24-40(25-21-28)22-9-23-41-35-12-7-8-13-36(35)42-37(41)27-30-26-32(39(4)34-11-6-5-10-33(30)34)19-16-29-14-17-31(18-15-29)38(2)3;/h5-8,10-19,26-28H,9,20-25H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | QXZRPPRUYIDRQX-UHFFFAOYSA-M |
| XLogP | 4.94 |
| TPSA | 13.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.75 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|