C23H25BrF2N4O — CID 164625382
N-[(4-bromo-3,5-difluorophenyl)methyl]-1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-amine (PubChem CID 164625382) has the molecular formula C23H25BrF2N4O and a molecular weight of 491.38 g/mol. Its IUPAC name is N-[(4-bromo-3,5-difluorophenyl)methyl]-1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-amine.
| Compound Name | N-[(4-bromo-3,5-difluorophenyl)methyl]-1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-amine |
|---|---|
| PubChem CID | 164625382 |
| Molecular Formula | C23H25BrF2N4O |
| Molecular Weight | 491.38 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | N-[(4-bromo-3,5-difluorophenyl)methyl]-1-[2-(6-methoxy-1,5-naphthyridin-4-yl)ethyl]piperidin-4-amine |
| SMILES | COc1ccc2nccc(CCN3CCC(NCc4cc(F)c(Br)c(F)c4)CC3)c2n1 |
| InChI | InChI=1S/C23H25BrF2N4O/c1-31-21-3-2-20-23(29-21)16(4-8-27-20)5-9-30-10-6-17(7-11-30)28-14-15-12-18(25)22(24)19(26)13-15/h2-4,8,12-13,17,28H,5-7,9-11,14H2,1H3 |
| InChIKey | RDTDFCZCBIXFEI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.38 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|