C32H36N8O6 — CID 164625392
[2-[4-(4-methylpiperazin-1-yl)-3-nitroanilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate (PubChem CID 164625392) has the molecular formula C32H36N8O6 and a molecular weight of 628.69 g/mol. Its IUPAC name is [2-[4-(4-methylpiperazin-1-yl)-3-nitroanilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate.
| Compound Name | [2-[4-(4-methylpiperazin-1-yl)-3-nitroanilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 164625392 |
| Molecular Formula | C32H36N8O6 |
| Molecular Weight | 628.69 g/mol |
| Exact Mass | 628.28 |
| IUPAC Name | [2-[4-(4-methylpiperazin-1-yl)-3-nitroanilino]-4-[3-(prop-2-enoylamino)phenoxy]pyrrolo[2,3-d]pyrimidin-7-yl]methyl 2,2-dimethylpropanoate |
| SMILES | C=CC(=O)Nc1cccc(Oc2nc(Nc3ccc(N4CCN(C)CC4)c([N+](=O)[O-])c3)nc3c2ccn3COC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C32H36N8O6/c1-6-27(41)33-21-8-7-9-23(18-21)46-29-24-12-13-39(20-45-30(42)32(2,3)4)28(24)35-31(36-29)34-22-10-11-25(26(19-22)40(43)44)38-16-14-37(5)15-17-38/h6-13,18-19H,1,14-17,20H2,2-5H3,(H,33,41)(H,34,35,36) |
| InChIKey | SGYUQRYZKPOEIF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 156.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.69 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|