C32H32ClN5O3 — CID 164625397
N-(7-chloroquinolin-4-yl)-N'-[4-(3,4-dimethoxyphenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]butane-1,4-diamine (PubChem CID 164625397) has the molecular formula C32H32ClN5O3 and a molecular weight of 570.09 g/mol. Its IUPAC name is N-(7-chloroquinolin-4-yl)-N'-[4-(3,4-dimethoxyphenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]butane-1,4-diamine.
| Compound Name | N-(7-chloroquinolin-4-yl)-N'-[4-(3,4-dimethoxyphenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]butane-1,4-diamine |
|---|---|
| PubChem CID | 164625397 |
| Molecular Formula | C32H32ClN5O3 |
| Molecular Weight | 570.09 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | N-(7-chloroquinolin-4-yl)-N'-[4-(3,4-dimethoxyphenyl)-6-(4-methoxyphenyl)pyrimidin-2-yl]butane-1,4-diamine |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)c(OC)c3)nc(NCCCCNc3ccnc4cc(Cl)ccc34)n2)cc1 |
| InChI | InChI=1S/C32H32ClN5O3/c1-39-24-10-6-21(7-11-24)27-20-28(22-8-13-30(40-2)31(18-22)41-3)38-32(37-27)36-16-5-4-15-34-26-14-17-35-29-19-23(33)9-12-25(26)29/h6-14,17-20H,4-5,15-16H2,1-3H3,(H,34,35)(H,36,37,38) |
| InChIKey | UIZHLMQWFIBPCH-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.09 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|